C13H13ClN2O5 — CID 43427424
1-[(2-chloro-5-nitrobenzoyl)amino]cyclopentane-1-carboxylic acid (PubChem CID 43427424) has the molecular formula C13H13ClN2O5 and a molecular weight of 312.71 g/mol. Its IUPAC name is 1-[(2-chloro-5-nitrobenzoyl)amino]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[(2-chloro-5-nitrobenzoyl)amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 43427424 |
| Molecular Formula | C13H13ClN2O5 |
| Molecular Weight | 312.71 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 1-[(2-chloro-5-nitrobenzoyl)amino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCCC1)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C13H13ClN2O5/c14-10-4-3-8(16(20)21)7-9(10)11(17)15-13(12(18)19)5-1-2-6-13/h3-4,7H,1-2,5-6H2,(H,15,17)(H,18,19) |
| InChIKey | ZYLPHGKHNIBDRP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.71 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|