C15H17ClN2O5 — CID 25467190
methyl 1-[(2-chloro-4-nitrobenzoyl)amino]cyclohexane-1-carboxylate (PubChem CID 25467190) has the molecular formula C15H17ClN2O5 and a molecular weight of 340.76 g/mol. Its IUPAC name is methyl 1-[(2-chloro-4-nitrobenzoyl)amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-[(2-chloro-4-nitrobenzoyl)amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 25467190 |
| Molecular Formula | C15H17ClN2O5 |
| Molecular Weight | 340.76 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | methyl 1-[(2-chloro-4-nitrobenzoyl)amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)c2ccc([N+](=O)[O-])cc2Cl)CCCCC1 |
| InChI | InChI=1S/C15H17ClN2O5/c1-23-14(20)15(7-3-2-4-8-15)17-13(19)11-6-5-10(18(21)22)9-12(11)16/h5-6,9H,2-4,7-8H2,1H3,(H,17,19) |
| InChIKey | LAQHOTFQGXQTLD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.76 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|