C15H17ClN2O6 — CID 120542903
4-[[[2-(2-chloro-4-nitrophenyl)acetyl]amino]methyl]oxane-4-carboxylic acid (PubChem CID 120542903) has the molecular formula C15H17ClN2O6 and a molecular weight of 356.76 g/mol. Its IUPAC name is 4-[[[2-(2-chloro-4-nitrophenyl)acetyl]amino]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[[2-(2-chloro-4-nitrophenyl)acetyl]amino]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 120542903 |
| Molecular Formula | C15H17ClN2O6 |
| Molecular Weight | 356.76 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 4-[[[2-(2-chloro-4-nitrophenyl)acetyl]amino]methyl]oxane-4-carboxylic acid |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1Cl)NCC1(C(=O)O)CCOCC1 |
| InChI | InChI=1S/C15H17ClN2O6/c16-12-8-11(18(22)23)2-1-10(12)7-13(19)17-9-15(14(20)21)3-5-24-6-4-15/h1-2,8H,3-7,9H2,(H,17,19)(H,20,21) |
| InChIKey | NFFODTDHPMDVRH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.76 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|