C13H13BrN2O5 — CID 120530919
1-[[2-(2-bromo-4-nitrophenyl)acetyl]amino]cyclobutane-1-carboxylic acid (PubChem CID 120530919) has the molecular formula C13H13BrN2O5 and a molecular weight of 357.16 g/mol. Its IUPAC name is 1-[[2-(2-bromo-4-nitrophenyl)acetyl]amino]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[[2-(2-bromo-4-nitrophenyl)acetyl]amino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120530919 |
| Molecular Formula | C13H13BrN2O5 |
| Molecular Weight | 357.16 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | 1-[[2-(2-bromo-4-nitrophenyl)acetyl]amino]cyclobutane-1-carboxylic acid |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1Br)NC1(C(=O)O)CCC1 |
| InChI | InChI=1S/C13H13BrN2O5/c14-10-7-9(16(20)21)3-2-8(10)6-11(17)15-13(12(18)19)4-1-5-13/h2-3,7H,1,4-6H2,(H,15,17)(H,18,19) |
| InChIKey | RJLLMOYPHIANFZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.16 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|