C13H13BrN2O5S — CID 120531418
3-[[2-(2-bromo-4-nitrophenyl)acetyl]amino]thiolane-3-carboxylic acid (PubChem CID 120531418) has the molecular formula C13H13BrN2O5S and a molecular weight of 389.23 g/mol. Its IUPAC name is 3-[[2-(2-bromo-4-nitrophenyl)acetyl]amino]thiolane-3-carboxylic acid.
| Compound Name | 3-[[2-(2-bromo-4-nitrophenyl)acetyl]amino]thiolane-3-carboxylic acid |
|---|---|
| PubChem CID | 120531418 |
| Molecular Formula | C13H13BrN2O5S |
| Molecular Weight | 389.23 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | 3-[[2-(2-bromo-4-nitrophenyl)acetyl]amino]thiolane-3-carboxylic acid |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1Br)NC1(C(=O)O)CCSC1 |
| InChI | InChI=1S/C13H13BrN2O5S/c14-10-6-9(16(20)21)2-1-8(10)5-11(17)15-13(12(18)19)3-4-22-7-13/h1-2,6H,3-5,7H2,(H,15,17)(H,18,19) |
| InChIKey | QGDYTBOCLIFFDL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|