C12H17N3O5 — CID 66222001
N-[(2,4-dinitrophenyl)methyl]-1-methoxybutan-2-amine (PubChem CID 66222001) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is N-[(2,4-dinitrophenyl)methyl]-1-methoxybutan-2-amine.
| Compound Name | N-[(2,4-dinitrophenyl)methyl]-1-methoxybutan-2-amine |
|---|---|
| PubChem CID | 66222001 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-[(2,4-dinitrophenyl)methyl]-1-methoxybutan-2-amine |
| SMILES | CCC(COC)NCc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17N3O5/c1-3-10(8-20-2)13-7-9-4-5-11(14(16)17)6-12(9)15(18)19/h4-6,10,13H,3,7-8H2,1-2H3 |
| InChIKey | LMRPKFVFFNVMKB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|