C12H17BrN2O4 — CID 106156719
3-[(4-bromo-2-nitrophenyl)methylamino]-4-methoxybutan-1-ol (PubChem CID 106156719) has the molecular formula C12H17BrN2O4 and a molecular weight of 333.18 g/mol. Its IUPAC name is 3-[(4-bromo-2-nitrophenyl)methylamino]-4-methoxybutan-1-ol.
| Compound Name | 3-[(4-bromo-2-nitrophenyl)methylamino]-4-methoxybutan-1-ol |
|---|---|
| PubChem CID | 106156719 |
| Molecular Formula | C12H17BrN2O4 |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 3-[(4-bromo-2-nitrophenyl)methylamino]-4-methoxybutan-1-ol |
| SMILES | COCC(CCO)NCc1ccc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17BrN2O4/c1-19-8-11(4-5-16)14-7-9-2-3-10(13)6-12(9)15(17)18/h2-3,6,11,14,16H,4-5,7-8H2,1H3 |
| InChIKey | QFAPIPMVVZOBLF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|