C12H15N3O6 — CID 66220925
2-[(2,4-dinitrophenyl)methylamino]pentanoic acid (PubChem CID 66220925) has the molecular formula C12H15N3O6 and a molecular weight of 297.27 g/mol. Its IUPAC name is 2-[(2,4-dinitrophenyl)methylamino]pentanoic acid.
| Compound Name | 2-[(2,4-dinitrophenyl)methylamino]pentanoic acid |
|---|---|
| PubChem CID | 66220925 |
| Molecular Formula | C12H15N3O6 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-[(2,4-dinitrophenyl)methylamino]pentanoic acid |
| SMILES | CCCC(NCc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C12H15N3O6/c1-2-3-10(12(16)17)13-7-8-4-5-9(14(18)19)6-11(8)15(20)21/h4-6,10,13H,2-3,7H2,1H3,(H,16,17) |
| InChIKey | SYIJDEYMPUUZSZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|