C11H14N4O5 — CID 66221346
2-[(2,4-dinitrophenyl)methylamino]-N-ethylacetamide (PubChem CID 66221346) has the molecular formula C11H14N4O5 and a molecular weight of 282.26 g/mol. Its IUPAC name is 2-[(2,4-dinitrophenyl)methylamino]-N-ethylacetamide.
| Compound Name | 2-[(2,4-dinitrophenyl)methylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 66221346 |
| Molecular Formula | C11H14N4O5 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-[(2,4-dinitrophenyl)methylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CNCc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14N4O5/c1-2-13-11(16)7-12-6-8-3-4-9(14(17)18)5-10(8)15(19)20/h3-5,12H,2,6-7H2,1H3,(H,13,16) |
| InChIKey | RPRIWBAUOMXMFG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|