C11H14BrN3O3 — CID 114048733
2-[(2-bromo-3-nitrophenyl)methylamino]-N-ethylacetamide (PubChem CID 114048733) has the molecular formula C11H14BrN3O3 and a molecular weight of 316.16 g/mol. Its IUPAC name is 2-[(2-bromo-3-nitrophenyl)methylamino]-N-ethylacetamide.
| Compound Name | 2-[(2-bromo-3-nitrophenyl)methylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 114048733 |
| Molecular Formula | C11H14BrN3O3 |
| Molecular Weight | 316.16 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 2-[(2-bromo-3-nitrophenyl)methylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CNCc1cccc([N+](=O)[O-])c1Br |
| InChI | InChI=1S/C11H14BrN3O3/c1-2-14-10(16)7-13-6-8-4-3-5-9(11(8)12)15(17)18/h3-5,13H,2,6-7H2,1H3,(H,14,16) |
| InChIKey | COQIOBMGBQAEEE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.16 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|