C11H11N3O7 — CID 71384663
(2S)-2-[(2,4-dinitrobenzoyl)amino]butanoic acid (PubChem CID 71384663) has the molecular formula C11H11N3O7 and a molecular weight of 297.22 g/mol. Its IUPAC name is (2S)-2-[(2,4-dinitrobenzoyl)amino]butanoic acid.
| Compound Name | (2S)-2-[(2,4-dinitrobenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 71384663 |
| Molecular Formula | C11H11N3O7 |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | (2S)-2-[(2,4-dinitrobenzoyl)amino]butanoic acid |
| SMILES | CC[C@H](NC(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C11H11N3O7/c1-2-8(11(16)17)12-10(15)7-4-3-6(13(18)19)5-9(7)14(20)21/h3-5,8H,2H2,1H3,(H,12,15)(H,16,17)/t8-/m0/s1 |
| InChIKey | VOYNKSNHJHLKDG-QMMMGPOBSA-N |
| XLogP | 1.10 |
| TPSA | 152.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|