C9H8N2O5 — CID 606980
1-(2,4-dinitrophenyl)propan-1-one (PubChem CID 606980) has the molecular formula C9H8N2O5 and a molecular weight of 224.17 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)propan-1-one.
| Compound Name | 1-(2,4-dinitrophenyl)propan-1-one |
|---|---|
| PubChem CID | 606980 |
| Molecular Formula | C9H8N2O5 |
| Molecular Weight | 224.17 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 1-(2,4-dinitrophenyl)propan-1-one |
| SMILES | CCC(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8N2O5/c1-2-9(12)7-4-3-6(10(13)14)5-8(7)11(15)16/h3-5H,2H2,1H3 |
| InChIKey | ABBRPQOHFIQUPF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.17 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|