About 4-nitro-2-propylbenzoyl bromide
4-nitro-2-propylbenzoyl bromide (PubChem CID 22920954) has the molecular formula C10H10BrNO3
and a molecular weight of 272.10 g/mol. Its IUPAC name is 4-nitro-2-propylbenzoyl bromide.
Molecular Properties
| Compound Name | 4-nitro-2-propylbenzoyl bromide |
| PubChem CID | 22920954 |
| Molecular Formula | C10H10BrNO3 |
| Molecular Weight | 272.10 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 4-nitro-2-propylbenzoyl bromide |
| SMILES | CCCc1cc([N+](=O)[O-])ccc1C(=O)Br |
| InChI | InChI=1S/C10H10BrNO3/c1-2-3-7-6-8(12(14)15)4-5-9(7)10(11)13/h4-6H,2-3H2,1H3 |
| InChIKey | LGJJKMGSVWNXQB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.10 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-2-propylbenzoyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-2-propylbenzoyl bromide?
The IUPAC name of 4-nitro-2-propylbenzoyl bromide (CID 22920954) is 4-nitro-2-propylbenzoyl bromide.
What is the SMILES notation for 4-nitro-2-propylbenzoyl bromide?
The canonical SMILES for 4-nitro-2-propylbenzoyl bromide is CCCc1cc([N+](=O)[O-])ccc1C(=O)Br.
What is the InChIKey of 4-nitro-2-propylbenzoyl bromide?
The InChIKey is LGJJKMGSVWNXQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrNO3/c1-2-3-7-6-8(12(14)15)4-5-9(7)10(11)13/h4-6H,2-3H2,1H3.
What are the key properties of 4-nitro-2-propylbenzoyl bromide?
4-nitro-2-propylbenzoyl bromide has a molecular weight of 272.10 g/mol, XLogP of 3.08, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-2-propylbenzoyl bromide is sourced from PubChem (CID 22920954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).