About 4-nitro-2-propylaniline
4-nitro-2-propylaniline (PubChem CID 21492038) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 4-nitro-2-propylaniline.
Molecular Properties
| Compound Name | 4-nitro-2-propylaniline |
| PubChem CID | 21492038 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 4-nitro-2-propylaniline |
| SMILES | CCCc1cc([N+](=O)[O-])ccc1N |
| InChI | InChI=1S/C9H12N2O2/c1-2-3-7-6-8(11(12)13)4-5-9(7)10/h4-6H,2-3,10H2,1H3 |
| InChIKey | ASRZMIQNPATDSA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-2-propylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-2-propylaniline?
The IUPAC name of 4-nitro-2-propylaniline (CID 21492038) is 4-nitro-2-propylaniline.
What is the SMILES notation for 4-nitro-2-propylaniline?
The canonical SMILES for 4-nitro-2-propylaniline is CCCc1cc([N+](=O)[O-])ccc1N.
What is the InChIKey of 4-nitro-2-propylaniline?
The InChIKey is ASRZMIQNPATDSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-2-3-7-6-8(11(12)13)4-5-9(7)10/h4-6H,2-3,10H2,1H3.
What are the key properties of 4-nitro-2-propylaniline?
4-nitro-2-propylaniline has a molecular weight of 180.21 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-2-propylaniline is sourced from PubChem (CID 21492038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).