C8H7F3N2O2 — CID 21397755
4-nitro-2-(2,2,2-trifluoroethyl)aniline (PubChem CID 21397755) has the molecular formula C8H7F3N2O2 and a molecular weight of 220.15 g/mol. Its IUPAC name is 4-nitro-2-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 4-nitro-2-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 21397755 |
| Molecular Formula | C8H7F3N2O2 |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 4-nitro-2-(2,2,2-trifluoroethyl)aniline |
| SMILES | Nc1ccc([N+](=O)[O-])cc1CC(F)(F)F |
| InChI | InChI=1S/C8H7F3N2O2/c9-8(10,11)4-5-3-6(13(14)15)1-2-7(5)12/h1-3H,4,12H2 |
| InChIKey | NTSSDEDMXWZOCZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|