C8H6F3N3O2 — CID 155135045
4-nitro-2-(2,2,2-trifluoroethanimidoyl)aniline (PubChem CID 155135045) has the molecular formula C8H6F3N3O2 and a molecular weight of 233.15 g/mol. Its IUPAC name is 4-nitro-2-(2,2,2-trifluoroethanimidoyl)aniline.
| Compound Name | 4-nitro-2-(2,2,2-trifluoroethanimidoyl)aniline |
|---|---|
| PubChem CID | 155135045 |
| Molecular Formula | C8H6F3N3O2 |
| Molecular Weight | 233.15 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 4-nitro-2-(2,2,2-trifluoroethanimidoyl)aniline |
| SMILES | [H]/N=C(/c1cc([N+](=O)[O-])ccc1N)C(F)(F)F |
| InChI | InChI=1S/C8H6F3N3O2/c9-8(10,11)7(13)5-3-4(14(15)16)1-2-6(5)12/h1-3,13H,12H2/b13-7- |
| InChIKey | ZUUROHKYOIYQCY-QPEQYQDCSA-N |
| XLogP | 2.11 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.15 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|