C12H14F3N3O3 — CID 129358451
2-amino-5-nitro-N-[(3R)-1,1,1-trifluoropentan-3-yl]benzamide (PubChem CID 129358451) has the molecular formula C12H14F3N3O3 and a molecular weight of 305.26 g/mol. Its IUPAC name is 2-amino-5-nitro-N-[(3R)-1,1,1-trifluoropentan-3-yl]benzamide.
| Compound Name | 2-amino-5-nitro-N-[(3R)-1,1,1-trifluoropentan-3-yl]benzamide |
|---|---|
| PubChem CID | 129358451 |
| Molecular Formula | C12H14F3N3O3 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-amino-5-nitro-N-[(3R)-1,1,1-trifluoropentan-3-yl]benzamide |
| SMILES | CC[C@H](CC(F)(F)F)NC(=O)c1cc([N+](=O)[O-])ccc1N |
| InChI | InChI=1S/C12H14F3N3O3/c1-2-7(6-12(13,14)15)17-11(19)9-5-8(18(20)21)3-4-10(9)16/h3-5,7H,2,6,16H2,1H3,(H,17,19)/t7-/m1/s1 |
| InChIKey | LCQQIPRBLFGDPF-SSDOTTSWSA-N |
| XLogP | 2.64 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|