C16H21N5O3 — CID 99790565
2-amino-5-nitro-N-[(1R)-1-(1,3,5-trimethylpyrazol-4-yl)propyl]benzamide (PubChem CID 99790565) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-amino-5-nitro-N-[(1R)-1-(1,3,5-trimethylpyrazol-4-yl)propyl]benzamide.
| Compound Name | 2-amino-5-nitro-N-[(1R)-1-(1,3,5-trimethylpyrazol-4-yl)propyl]benzamide |
|---|---|
| PubChem CID | 99790565 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-amino-5-nitro-N-[(1R)-1-(1,3,5-trimethylpyrazol-4-yl)propyl]benzamide |
| SMILES | CC[C@@H](NC(=O)c1cc([N+](=O)[O-])ccc1N)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C16H21N5O3/c1-5-14(15-9(2)19-20(4)10(15)3)18-16(22)12-8-11(21(23)24)6-7-13(12)17/h6-8,14H,5,17H2,1-4H3,(H,18,22)/t14-/m1/s1 |
| InChIKey | PHRMIYYVLXQEFU-CQSZACIVSA-N |
| XLogP | 2.41 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|