C17H23N3O2 — CID 95898801
2-methoxy-N-[(1S)-1-(1,3,5-trimethylpyrazol-4-yl)propyl]benzamide (PubChem CID 95898801) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-methoxy-N-[(1S)-1-(1,3,5-trimethylpyrazol-4-yl)propyl]benzamide.
| Compound Name | 2-methoxy-N-[(1S)-1-(1,3,5-trimethylpyrazol-4-yl)propyl]benzamide |
|---|---|
| PubChem CID | 95898801 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 2-methoxy-N-[(1S)-1-(1,3,5-trimethylpyrazol-4-yl)propyl]benzamide |
| SMILES | CC[C@H](NC(=O)c1ccccc1OC)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C17H23N3O2/c1-6-14(16-11(2)19-20(4)12(16)3)18-17(21)13-9-7-8-10-15(13)22-5/h7-10,14H,6H2,1-5H3,(H,18,21)/t14-/m0/s1 |
| InChIKey | XFGLJHCKEAGLQI-AWEZNQCLSA-N |
| XLogP | 2.93 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |