C14H17N3O4S — CID 47052132
2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)sulfonylbenzamide (PubChem CID 47052132) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is 2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)sulfonylbenzamide.
| Compound Name | 2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 47052132 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)sulfonylbenzamide |
| SMILES | COc1ccccc1C(=O)NS(=O)(=O)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C14H17N3O4S/c1-9-13(10(2)17(3)15-9)22(19,20)16-14(18)11-7-5-6-8-12(11)21-4/h5-8H,1-4H3,(H,16,18) |
| InChIKey | VFGMYWKNVJVVJI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |