C6H7N3O8S — CID 174852217
2,4-dinitroaniline;sulfuric acid (PubChem CID 174852217) has the molecular formula C6H7N3O8S and a molecular weight of 281.20 g/mol. Its IUPAC name is 2,4-dinitroaniline;sulfuric acid.
| Compound Name | 2,4-dinitroaniline;sulfuric acid |
|---|---|
| PubChem CID | 174852217 |
| Molecular Formula | C6H7N3O8S |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 2,4-dinitroaniline;sulfuric acid |
| SMILES | Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].O=S(=O)(O)O |
| InChI | InChI=1S/C6H5N3O4.H2O4S/c7-5-2-1-4(8(10)11)3-6(5)9(12)13;1-5(2,3)4/h1-3H,7H2;(H2,1,2,3,4) |
| InChIKey | PAYAXGCNSRDJTP-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 186.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|