2-bromo-4,6-dinitroaniline;sulfuric acid

C6H6BrN3O8S — CID 174616182

IUPAC2-bromo-4,6-dinitroaniline;sulfuric acid
SMILESNc1c(Br)cc([N+](=O)[O-])cc1[N+](=O)[O-].O=S(=O)(O)O
InChIInChI=1S/C6H4BrN3O4.H2O4S/c7-4-1-3(9(11)12)2-5(6(4)8)10(13)14;1-5(2,3)4/h1-2H,8H2;(H2,1,2,3,4)
InChIKeyOZDHMJJFBJVUPL-UHFFFAOYSA-N
MW360.10 g/mol
LogP1.19
Rot. Bonds2

About 2-bromo-4,6-dinitroaniline;sulfuric acid

2-bromo-4,6-dinitroaniline;sulfuric acid (PubChem CID 174616182) has the molecular formula C6H6BrN3O8S and a molecular weight of 360.10 g/mol. Its IUPAC name is 2-bromo-4,6-dinitroaniline;sulfuric acid.

Molecular Properties

Compound Name2-bromo-4,6-dinitroaniline;sulfuric acid
PubChem CID174616182
Molecular FormulaC6H6BrN3O8S
Molecular Weight360.10 g/mol
Exact Mass358.91
IUPAC Name2-bromo-4,6-dinitroaniline;sulfuric acid
SMILESNc1c(Br)cc([N+](=O)[O-])cc1[N+](=O)[O-].O=S(=O)(O)O
InChIInChI=1S/C6H4BrN3O4.H2O4S/c7-4-1-3(9(11)12)2-5(6(4)8)10(13)14;1-5(2,3)4/h1-2H,8H2;(H2,1,2,3,4)
InChIKeyOZDHMJJFBJVUPL-UHFFFAOYSA-N
XLogP1.19
TPSA186.90 Ų
H-Bond Donors3
H-Bond Acceptors7
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500360.10
LogP ≤ 51.19
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-bromo-4,6-dinitroaniline;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-bromo-4,6-dinitroaniline;sulfuric acid?
The IUPAC name of 2-bromo-4,6-dinitroaniline;sulfuric acid (CID 174616182) is 2-bromo-4,6-dinitroaniline;sulfuric acid.
What is the SMILES notation for 2-bromo-4,6-dinitroaniline;sulfuric acid?
The canonical SMILES for 2-bromo-4,6-dinitroaniline;sulfuric acid is Nc1c(Br)cc([N+](=O)[O-])cc1[N+](=O)[O-].O=S(=O)(O)O.
What is the InChIKey of 2-bromo-4,6-dinitroaniline;sulfuric acid?
The InChIKey is OZDHMJJFBJVUPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrN3O4.H2O4S/c7-4-1-3(9(11)12)2-5(6(4)8)10(13)14;1-5(2,3)4/h1-2H,8H2;(H2,1,2,3,4).
What are the key properties of 2-bromo-4,6-dinitroaniline;sulfuric acid?
2-bromo-4,6-dinitroaniline;sulfuric acid has a molecular weight of 360.10 g/mol, XLogP of 1.19, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4,6-dinitroaniline;sulfuric acid is sourced from PubChem (CID 174616182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).