C14H12N6O10S — CID 54016601
2-[(2-amino-3,5-dinitrophenyl)methylsulfonylmethyl]-4,6-dinitroaniline (PubChem CID 54016601) has the molecular formula C14H12N6O10S and a molecular weight of 456.35 g/mol. Its IUPAC name is 2-[(2-amino-3,5-dinitrophenyl)methylsulfonylmethyl]-4,6-dinitroaniline.
| Compound Name | 2-[(2-amino-3,5-dinitrophenyl)methylsulfonylmethyl]-4,6-dinitroaniline |
|---|---|
| PubChem CID | 54016601 |
| Molecular Formula | C14H12N6O10S |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | 2-[(2-amino-3,5-dinitrophenyl)methylsulfonylmethyl]-4,6-dinitroaniline |
| SMILES | Nc1c(CS(=O)(=O)Cc2cc([N+](=O)[O-])cc([N+](=O)[O-])c2N)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12N6O10S/c15-13-7(1-9(17(21)22)3-11(13)19(25)26)5-31(29,30)6-8-2-10(18(23)24)4-12(14(8)16)20(27)28/h1-4H,5-6,15-16H2 |
| InChIKey | KWAXPNSWICZXMJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 258.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|