strontium bis(2,4,6-trinitrophenolate)

C12H4N6O14Sr — CID 90471623

IUPACstrontium bis(2,4,6-trinitrophenolate)
SMILESO=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1.O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1.[Sr+2]
InChIInChI=1S/2C6H3N3O7.Sr/c2*10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;/h2*1-2,10H;/q;;+2/p-2
InChIKeyJWDCIZFRVVHBJE-UHFFFAOYSA-L
MW543.81 g/mol
LogP0.59
Rot. Bonds6

About strontium bis(2,4,6-trinitrophenolate)

strontium bis(2,4,6-trinitrophenolate) (PubChem CID 90471623) has the molecular formula C12H4N6O14Sr and a molecular weight of 543.81 g/mol. Its IUPAC name is strontium bis(2,4,6-trinitrophenolate).

Molecular Properties

Compound Namestrontium bis(2,4,6-trinitrophenolate)
PubChem CID90471623
Molecular FormulaC12H4N6O14Sr
Molecular Weight543.81 g/mol
Exact Mass543.88
IUPAC Namestrontium bis(2,4,6-trinitrophenolate)
SMILESO=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1.O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1.[Sr+2]
InChIInChI=1S/2C6H3N3O7.Sr/c2*10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;/h2*1-2,10H;/q;;+2/p-2
InChIKeyJWDCIZFRVVHBJE-UHFFFAOYSA-L
XLogP0.59
TPSA304.96 Ų
H-Bond Donors
H-Bond Acceptors14
Rotatable Bonds6
Heavy Atoms33
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500543.81
LogP ≤ 50.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 1014

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze strontium bis(2,4,6-trinitrophenolate) with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of strontium bis(2,4,6-trinitrophenolate)?
The IUPAC name of strontium bis(2,4,6-trinitrophenolate) (CID 90471623) is strontium bis(2,4,6-trinitrophenolate).
What is the SMILES notation for strontium bis(2,4,6-trinitrophenolate)?
The canonical SMILES for strontium bis(2,4,6-trinitrophenolate) is O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1.O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1.[Sr+2].
What is the InChIKey of strontium bis(2,4,6-trinitrophenolate)?
The InChIKey is JWDCIZFRVVHBJE-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H3N3O7.Sr/c2*10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;/h2*1-2,10H;/q;;+2/p-2.
What are the key properties of strontium bis(2,4,6-trinitrophenolate)?
strontium bis(2,4,6-trinitrophenolate) has a molecular weight of 543.81 g/mol, XLogP of 0.59, 6 rotatable bonds, 0 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for strontium bis(2,4,6-trinitrophenolate) is sourced from PubChem (CID 90471623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).