C12H4N6O14Sr — CID 90471623
strontium bis(2,4,6-trinitrophenolate) (PubChem CID 90471623) has the molecular formula C12H4N6O14Sr and a molecular weight of 543.81 g/mol. Its IUPAC name is strontium bis(2,4,6-trinitrophenolate).
| Compound Name | strontium bis(2,4,6-trinitrophenolate) |
|---|---|
| PubChem CID | 90471623 |
| Molecular Formula | C12H4N6O14Sr |
| Molecular Weight | 543.81 g/mol |
| Exact Mass | 543.88 |
| IUPAC Name | strontium bis(2,4,6-trinitrophenolate) |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1.O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1.[Sr+2] |
| InChI | InChI=1S/2C6H3N3O7.Sr/c2*10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;/h2*1-2,10H;/q;;+2/p-2 |
| InChIKey | JWDCIZFRVVHBJE-UHFFFAOYSA-L |
| XLogP | 0.59 |
| TPSA | 304.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.81 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|