C12H4CaN6O14 — CID 517024
calcium bis(2,4,6-trinitrophenolate) (PubChem CID 517024) has the molecular formula C12H4CaN6O14 and a molecular weight of 496.27 g/mol. Its IUPAC name is calcium bis(2,4,6-trinitrophenolate).
| Compound Name | calcium bis(2,4,6-trinitrophenolate) |
|---|---|
| PubChem CID | 517024 |
| Molecular Formula | C12H4CaN6O14 |
| Molecular Weight | 496.27 g/mol |
| Exact Mass | 495.94 |
| IUPAC Name | calcium bis(2,4,6-trinitrophenolate) |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1.O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1.[Ca+2] |
| InChI | InChI=1S/2C6H3N3O7.Ca/c2*10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;/h2*1-2,10H;/q;;+2/p-2 |
| InChIKey | IMPNEEMVYLGDTR-UHFFFAOYSA-L |
| XLogP | 0.59 |
| TPSA | 304.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|