About sodium 4-methyl-2,6-dinitrophenolate
sodium 4-methyl-2,6-dinitrophenolate (PubChem CID 102438433) has the molecular formula C7H5N2NaO5
and a molecular weight of 220.12 g/mol. Its IUPAC name is sodium 4-methyl-2,6-dinitrophenolate.
Molecular Properties
| Compound Name | sodium 4-methyl-2,6-dinitrophenolate |
| PubChem CID | 102438433 |
| Molecular Formula | C7H5N2NaO5 |
| Molecular Weight | 220.12 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | sodium 4-methyl-2,6-dinitrophenolate |
| SMILES | Cc1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C7H6N2O5.Na/c1-4-2-5(8(11)12)7(10)6(3-4)9(13)14;/h2-3,10H,1H3;/q;+1/p-1 |
| InChIKey | KXXUTJKDTLRQTQ-UHFFFAOYSA-M |
| XLogP | -2.11 |
| TPSA | 109.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.12 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium 4-methyl-2,6-dinitrophenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-methyl-2,6-dinitrophenolate?
The IUPAC name of sodium 4-methyl-2,6-dinitrophenolate (CID 102438433) is sodium 4-methyl-2,6-dinitrophenolate.
What is the SMILES notation for sodium 4-methyl-2,6-dinitrophenolate?
The canonical SMILES for sodium 4-methyl-2,6-dinitrophenolate is Cc1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1.[Na+].
What is the InChIKey of sodium 4-methyl-2,6-dinitrophenolate?
The InChIKey is KXXUTJKDTLRQTQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6N2O5.Na/c1-4-2-5(8(11)12)7(10)6(3-4)9(13)14;/h2-3,10H,1H3;/q;+1/p-1.
What are the key properties of sodium 4-methyl-2,6-dinitrophenolate?
sodium 4-methyl-2,6-dinitrophenolate has a molecular weight of 220.12 g/mol, XLogP of -2.11, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-methyl-2,6-dinitrophenolate is sourced from PubChem (CID 102438433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).