C10H9NO3 — CID 20643039
6-methyl-4-nitro-2,3-dihydroinden-1-one (PubChem CID 20643039) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 6-methyl-4-nitro-2,3-dihydroinden-1-one.
| Compound Name | 6-methyl-4-nitro-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 20643039 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 6-methyl-4-nitro-2,3-dihydroinden-1-one |
| SMILES | Cc1cc2c(c([N+](=O)[O-])c1)CCC2=O |
| InChI | InChI=1S/C10H9NO3/c1-6-4-8-7(2-3-10(8)12)9(5-6)11(13)14/h4-5H,2-3H2,1H3 |
| InChIKey | OPDCBHWQBUJGRJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|