C11H12FNO3 — CID 142529612
ethane;7-fluoro-4-nitro-2,3-dihydroinden-1-one (PubChem CID 142529612) has the molecular formula C11H12FNO3 and a molecular weight of 225.22 g/mol. Its IUPAC name is ethane;7-fluoro-4-nitro-2,3-dihydroinden-1-one.
| Compound Name | ethane;7-fluoro-4-nitro-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 142529612 |
| Molecular Formula | C11H12FNO3 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | ethane;7-fluoro-4-nitro-2,3-dihydroinden-1-one |
| SMILES | CC.O=C1CCc2c([N+](=O)[O-])ccc(F)c21 |
| InChI | InChI=1S/C9H6FNO3.C2H6/c10-6-2-3-7(11(13)14)5-1-4-8(12)9(5)6;1-2/h2-3H,1,4H2;1-2H3 |
| InChIKey | PTTFVJVWVSDOPK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|