C11H8N2O3 — CID 19990792
4-nitro-5-oxo-7,8-dihydro-6H-naphthalene-1-carbonitrile (PubChem CID 19990792) has the molecular formula C11H8N2O3 and a molecular weight of 216.20 g/mol. Its IUPAC name is 4-nitro-5-oxo-7,8-dihydro-6H-naphthalene-1-carbonitrile.
| Compound Name | 4-nitro-5-oxo-7,8-dihydro-6H-naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 19990792 |
| Molecular Formula | C11H8N2O3 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 4-nitro-5-oxo-7,8-dihydro-6H-naphthalene-1-carbonitrile |
| SMILES | N#Cc1ccc([N+](=O)[O-])c2c1CCCC2=O |
| InChI | InChI=1S/C11H8N2O3/c12-6-7-4-5-9(13(15)16)11-8(7)2-1-3-10(11)14/h4-5H,1-3H2 |
| InChIKey | LGAALHJLFHYCBN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|