About ethane;7-methyl-2,3-dihydro-1H-indene-4-carbonitrile
ethane;7-methyl-2,3-dihydro-1H-indene-4-carbonitrile (PubChem CID 142588105) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is ethane;7-methyl-2,3-dihydro-1H-indene-4-carbonitrile.
Analyze ethane;7-methyl-2,3-dihydro-1H-indene-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-methyl-2,3-dihydro-1H-indene-4-carbonitrile?
The IUPAC name of ethane;7-methyl-2,3-dihydro-1H-indene-4-carbonitrile (CID 142588105) is ethane;7-methyl-2,3-dihydro-1H-indene-4-carbonitrile.
What is the SMILES notation for ethane;7-methyl-2,3-dihydro-1H-indene-4-carbonitrile?
The canonical SMILES for ethane;7-methyl-2,3-dihydro-1H-indene-4-carbonitrile is CC.Cc1ccc(C#N)c2c1CCC2.
What is the InChIKey of ethane;7-methyl-2,3-dihydro-1H-indene-4-carbonitrile?
The InChIKey is ATQWQHBAYXLEKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N.C2H6/c1-8-5-6-9(7-12)11-4-2-3-10(8)11;1-2/h5-6H,2-4H2,1H3;1-2H3.
What are the key properties of ethane;7-methyl-2,3-dihydro-1H-indene-4-carbonitrile?
ethane;7-methyl-2,3-dihydro-1H-indene-4-carbonitrile has a molecular weight of 187.29 g/mol, XLogP of 3.38, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-methyl-2,3-dihydro-1H-indene-4-carbonitrile is sourced from PubChem (CID 142588105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).