C10H10BrN — CID 171013334
2-(bromomethyl)-3,4-dimethylbenzonitrile (PubChem CID 171013334) has the molecular formula C10H10BrN and a molecular weight of 224.10 g/mol. Its IUPAC name is 2-(bromomethyl)-3,4-dimethylbenzonitrile.
| Compound Name | 2-(bromomethyl)-3,4-dimethylbenzonitrile |
|---|---|
| PubChem CID | 171013334 |
| Molecular Formula | C10H10BrN |
| Molecular Weight | 224.10 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | 2-(bromomethyl)-3,4-dimethylbenzonitrile |
| SMILES | Cc1ccc(C#N)c(CBr)c1C |
| InChI | InChI=1S/C10H10BrN/c1-7-3-4-9(6-12)10(5-11)8(7)2/h3-4H,5H2,1-2H3 |
| InChIKey | BFHDEMDLMVCQRM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.10 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|