C15H18N2O5 — CID 178030878
butyl N-(4-nitro-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)carbamate (PubChem CID 178030878) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is butyl N-(4-nitro-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)carbamate.
| Compound Name | butyl N-(4-nitro-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)carbamate |
|---|---|
| PubChem CID | 178030878 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | butyl N-(4-nitro-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)carbamate |
| SMILES | CCCCOC(=O)Nc1ccc([N+](=O)[O-])c2c1CCCC2=O |
| InChI | InChI=1S/C15H18N2O5/c1-2-3-9-22-15(19)16-11-7-8-12(17(20)21)14-10(11)5-4-6-13(14)18/h7-8H,2-6,9H2,1H3,(H,16,19) |
| InChIKey | WTQNDYRDPMQISP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|