About butyl N-(4-nitro-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)carbamate
butyl N-(4-nitro-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)carbamate (PubChem CID 178030878) has the molecular formula C15H18N2O5
and a molecular weight of 306.32 g/mol. Its IUPAC name is butyl N-(4-nitro-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)carbamate.
Molecular Properties
| Compound Name | butyl N-(4-nitro-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)carbamate |
| PubChem CID | 178030878 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | butyl N-(4-nitro-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)carbamate |
| SMILES | CCCCOC(=O)Nc1ccc([N+](=O)[O-])c2c1CCCC2=O |
| InChI | InChI=1S/C15H18N2O5/c1-2-3-9-22-15(19)16-11-7-8-12(17(20)21)14-10(11)5-4-6-13(14)18/h7-8H,2-6,9H2,1H3,(H,16,19) |
| InChIKey | WTQNDYRDPMQISP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butyl N-(4-nitro-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl N-(4-nitro-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)carbamate?
The IUPAC name of butyl N-(4-nitro-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)carbamate (CID 178030878) is butyl N-(4-nitro-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)carbamate.
What is the SMILES notation for butyl N-(4-nitro-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)carbamate?
The canonical SMILES for butyl N-(4-nitro-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)carbamate is CCCCOC(=O)Nc1ccc([N+](=O)[O-])c2c1CCCC2=O.
What is the InChIKey of butyl N-(4-nitro-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)carbamate?
The InChIKey is WTQNDYRDPMQISP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O5/c1-2-3-9-22-15(19)16-11-7-8-12(17(20)21)14-10(11)5-4-6-13(14)18/h7-8H,2-6,9H2,1H3,(H,16,19).
What are the key properties of butyl N-(4-nitro-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)carbamate?
butyl N-(4-nitro-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)carbamate has a molecular weight of 306.32 g/mol, XLogP of 3.46, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butyl N-(4-nitro-5-oxo-7,8-dihydro-6H-naphthalen-1-yl)carbamate is sourced from PubChem (CID 178030878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).