C11H13Br2NO2 — CID 56698243
butyl N-(2,4-dibromophenyl)carbamate (PubChem CID 56698243) has the molecular formula C11H13Br2NO2 and a molecular weight of 351.04 g/mol. Its IUPAC name is butyl N-(2,4-dibromophenyl)carbamate.
| Compound Name | butyl N-(2,4-dibromophenyl)carbamate |
|---|---|
| PubChem CID | 56698243 |
| Molecular Formula | C11H13Br2NO2 |
| Molecular Weight | 351.04 g/mol |
| Exact Mass | 348.93 |
| IUPAC Name | butyl N-(2,4-dibromophenyl)carbamate |
| SMILES | CCCCOC(=O)Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H13Br2NO2/c1-2-3-6-16-11(15)14-10-5-4-8(12)7-9(10)13/h4-5,7H,2-3,6H2,1H3,(H,14,15) |
| InChIKey | YTKQBXGVPVHEKN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.04 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|