C13H20BrN3O2 — CID 142707705
butyl N-[2-(2-amino-4-bromoanilino)ethyl]carbamate (PubChem CID 142707705) has the molecular formula C13H20BrN3O2 and a molecular weight of 330.23 g/mol. Its IUPAC name is butyl N-[2-(2-amino-4-bromoanilino)ethyl]carbamate.
| Compound Name | butyl N-[2-(2-amino-4-bromoanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 142707705 |
| Molecular Formula | C13H20BrN3O2 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | butyl N-[2-(2-amino-4-bromoanilino)ethyl]carbamate |
| SMILES | CCCCOC(=O)NCCNc1ccc(Br)cc1N |
| InChI | InChI=1S/C13H20BrN3O2/c1-2-3-8-19-13(18)17-7-6-16-12-5-4-10(14)9-11(12)15/h4-5,9,16H,2-3,6-8,15H2,1H3,(H,17,18) |
| InChIKey | CMWRFLISDALSLH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|