C12H20BrN3 — CID 28902518
4-bromo-1-N-[2-(diethylamino)ethyl]benzene-1,2-diamine (PubChem CID 28902518) has the molecular formula C12H20BrN3 and a molecular weight of 286.22 g/mol. Its IUPAC name is 4-bromo-1-N-[2-(diethylamino)ethyl]benzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-[2-(diethylamino)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 28902518 |
| Molecular Formula | C12H20BrN3 |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 4-bromo-1-N-[2-(diethylamino)ethyl]benzene-1,2-diamine |
| SMILES | CCN(CC)CCNc1ccc(Br)cc1N |
| InChI | InChI=1S/C12H20BrN3/c1-3-16(4-2)8-7-15-12-6-5-10(13)9-11(12)14/h5-6,9,15H,3-4,7-8,14H2,1-2H3 |
| InChIKey | VKQKJOYCPNFRDB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|