C18H25N3 — CID 12714490
N-[2-(2-aminophenyl)phenyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 12714490) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is N-[2-(2-aminophenyl)phenyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[2-(2-aminophenyl)phenyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 12714490 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | N-[2-(2-aminophenyl)phenyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1ccccc1-c1ccccc1N |
| InChI | InChI=1S/C18H25N3/c1-3-21(4-2)14-13-20-18-12-8-6-10-16(18)15-9-5-7-11-17(15)19/h5-12,20H,3-4,13-14,19H2,1-2H3 |
| InChIKey | XWWJULFEQQJDFA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|