C14H24N2 — CID 28585667
N-(2,3-dimethylphenyl)-N',N'-diethylethane-1,2-diamine (PubChem CID 28585667) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-(2,3-dimethylphenyl)-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 28585667 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N-(2,3-dimethylphenyl)-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1cccc(C)c1C |
| InChI | InChI=1S/C14H24N2/c1-5-16(6-2)11-10-15-14-9-7-8-12(3)13(14)4/h7-9,15H,5-6,10-11H2,1-4H3 |
| InChIKey | VGYTWFHHFGGHPC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |