C13H22N2 — CID 54809532
N-(2,3-dimethylphenyl)-N'-propan-2-ylethane-1,2-diamine (PubChem CID 54809532) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-N'-propan-2-ylethane-1,2-diamine.
| Compound Name | N-(2,3-dimethylphenyl)-N'-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 54809532 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N-(2,3-dimethylphenyl)-N'-propan-2-ylethane-1,2-diamine |
| SMILES | Cc1cccc(NCCNC(C)C)c1C |
| InChI | InChI=1S/C13H22N2/c1-10(2)14-8-9-15-13-7-5-6-11(3)12(13)4/h5-7,10,14-15H,8-9H2,1-4H3 |
| InChIKey | IAPVPKBQSIYHOF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|