C15H20N2 — CID 115206310
N-naphthalen-1-yl-N'-propan-2-ylethane-1,2-diamine (PubChem CID 115206310) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N-naphthalen-1-yl-N'-propan-2-ylethane-1,2-diamine.
| Compound Name | N-naphthalen-1-yl-N'-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 115206310 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | N-naphthalen-1-yl-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)NCCNc1cccc2ccccc12 |
| InChI | InChI=1S/C15H20N2/c1-12(2)16-10-11-17-15-9-5-7-13-6-3-4-8-14(13)15/h3-9,12,16-17H,10-11H2,1-2H3 |
| InChIKey | OEWQMOAWAPRBAV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|