C13H19N3 — CID 115206245
N-(1H-indol-3-yl)-N'-propan-2-ylethane-1,2-diamine (PubChem CID 115206245) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is N-(1H-indol-3-yl)-N'-propan-2-ylethane-1,2-diamine.
| Compound Name | N-(1H-indol-3-yl)-N'-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 115206245 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | N-(1H-indol-3-yl)-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)NCCNc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C13H19N3/c1-10(2)14-7-8-15-13-9-16-12-6-4-3-5-11(12)13/h3-6,9-10,14-16H,7-8H2,1-2H3 |
| InChIKey | NPTXHKPGBHQISB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|