C11H15N3 — CID 115195726
N'-(1H-indol-3-yl)-N-methylethane-1,2-diamine (PubChem CID 115195726) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is N'-(1H-indol-3-yl)-N-methylethane-1,2-diamine.
| Compound Name | N'-(1H-indol-3-yl)-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 115195726 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | N'-(1H-indol-3-yl)-N-methylethane-1,2-diamine |
| SMILES | CNCCNc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C11H15N3/c1-12-6-7-13-11-8-14-10-5-3-2-4-9(10)11/h2-5,8,12-14H,6-7H2,1H3 |
| InChIKey | PXKQYLLSLBRUMB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|