About N-ethyl-1H-indol-3-amine
N-ethyl-1H-indol-3-amine (PubChem CID 22497863) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is N-ethyl-1H-indol-3-amine.
Molecular Properties
| Compound Name | N-ethyl-1H-indol-3-amine |
| PubChem CID | 22497863 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | N-ethyl-1H-indol-3-amine |
| SMILES | CCNc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C10H12N2/c1-2-11-10-7-12-9-6-4-3-5-8(9)10/h3-7,11-12H,2H2,1H3 |
| InChIKey | PJLFXDBIYFXLTE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-1H-indol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1H-indol-3-amine?
The IUPAC name of N-ethyl-1H-indol-3-amine (CID 22497863) is N-ethyl-1H-indol-3-amine.
What is the SMILES notation for N-ethyl-1H-indol-3-amine?
The canonical SMILES for N-ethyl-1H-indol-3-amine is CCNc1c[nH]c2ccccc12.
What is the InChIKey of N-ethyl-1H-indol-3-amine?
The InChIKey is PJLFXDBIYFXLTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-2-11-10-7-12-9-6-4-3-5-8(9)10/h3-7,11-12H,2H2,1H3.
What are the key properties of N-ethyl-1H-indol-3-amine?
N-ethyl-1H-indol-3-amine has a molecular weight of 160.22 g/mol, XLogP of 2.60, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1H-indol-3-amine is sourced from PubChem (CID 22497863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).