C17H23NO2 — CID 81094321
N-(3,3-diethoxypropyl)naphthalen-1-amine (PubChem CID 81094321) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is N-(3,3-diethoxypropyl)naphthalen-1-amine.
| Compound Name | N-(3,3-diethoxypropyl)naphthalen-1-amine |
|---|---|
| PubChem CID | 81094321 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | N-(3,3-diethoxypropyl)naphthalen-1-amine |
| SMILES | CCOC(CCNc1cccc2ccccc12)OCC |
| InChI | InChI=1S/C17H23NO2/c1-3-19-17(20-4-2)12-13-18-16-11-7-9-14-8-5-6-10-15(14)16/h5-11,17-18H,3-4,12-13H2,1-2H3 |
| InChIKey | LCOKDWFAQYIANS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|