C15H26N2O3 — CID 81093253
N-(3,3-diethoxypropyl)-2-propan-2-yloxypyridin-3-amine (PubChem CID 81093253) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is N-(3,3-diethoxypropyl)-2-propan-2-yloxypyridin-3-amine.
| Compound Name | N-(3,3-diethoxypropyl)-2-propan-2-yloxypyridin-3-amine |
|---|---|
| PubChem CID | 81093253 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | N-(3,3-diethoxypropyl)-2-propan-2-yloxypyridin-3-amine |
| SMILES | CCOC(CCNc1cccnc1OC(C)C)OCC |
| InChI | InChI=1S/C15H26N2O3/c1-5-18-14(19-6-2)9-11-16-13-8-7-10-17-15(13)20-12(3)4/h7-8,10,12,14,16H,5-6,9,11H2,1-4H3 |
| InChIKey | YPKZZOTVTUPIEB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|