C15H25NO2 — CID 81094600
N-(3,3-diethoxypropyl)-2-ethylaniline (PubChem CID 81094600) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is N-(3,3-diethoxypropyl)-2-ethylaniline.
| Compound Name | N-(3,3-diethoxypropyl)-2-ethylaniline |
|---|---|
| PubChem CID | 81094600 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | N-(3,3-diethoxypropyl)-2-ethylaniline |
| SMILES | CCOC(CCNc1ccccc1CC)OCC |
| InChI | InChI=1S/C15H25NO2/c1-4-13-9-7-8-10-14(13)16-12-11-15(17-5-2)18-6-3/h7-10,15-16H,4-6,11-12H2,1-3H3 |
| InChIKey | OPYXVLKORGJBEV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|