About N-(3,3-diethoxypropyl)-2,3-dihydro-1H-inden-2-amine
N-(3,3-diethoxypropyl)-2,3-dihydro-1H-inden-2-amine (PubChem CID 102977014) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is N-(3,3-diethoxypropyl)-2,3-dihydro-1H-inden-2-amine.
Molecular Properties
| Compound Name | N-(3,3-diethoxypropyl)-2,3-dihydro-1H-inden-2-amine |
| PubChem CID | 102977014 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N-(3,3-diethoxypropyl)-2,3-dihydro-1H-inden-2-amine |
| SMILES | CCOC(CCNC1Cc2ccccc2C1)OCC |
| InChI | InChI=1S/C16H25NO2/c1-3-18-16(19-4-2)9-10-17-15-11-13-7-5-6-8-14(13)12-15/h5-8,15-17H,3-4,9-12H2,1-2H3 |
| InChIKey | VIXVFFHNMRRAAY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(3,3-diethoxypropyl)-2,3-dihydro-1H-inden-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-diethoxypropyl)-2,3-dihydro-1H-inden-2-amine?
The IUPAC name of N-(3,3-diethoxypropyl)-2,3-dihydro-1H-inden-2-amine (CID 102977014) is N-(3,3-diethoxypropyl)-2,3-dihydro-1H-inden-2-amine.
What is the SMILES notation for N-(3,3-diethoxypropyl)-2,3-dihydro-1H-inden-2-amine?
The canonical SMILES for N-(3,3-diethoxypropyl)-2,3-dihydro-1H-inden-2-amine is CCOC(CCNC1Cc2ccccc2C1)OCC.
What is the InChIKey of N-(3,3-diethoxypropyl)-2,3-dihydro-1H-inden-2-amine?
The InChIKey is VIXVFFHNMRRAAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2/c1-3-18-16(19-4-2)9-10-17-15-11-13-7-5-6-8-14(13)12-15/h5-8,15-17H,3-4,9-12H2,1-2H3.
What are the key properties of N-(3,3-diethoxypropyl)-2,3-dihydro-1H-inden-2-amine?
N-(3,3-diethoxypropyl)-2,3-dihydro-1H-inden-2-amine has a molecular weight of 263.38 g/mol, XLogP of 2.53, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-diethoxypropyl)-2,3-dihydro-1H-inden-2-amine is sourced from PubChem (CID 102977014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).