C16H25N — CID 104694875
N-heptan-4-yl-2,3-dihydro-1H-inden-2-amine (PubChem CID 104694875) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is N-heptan-4-yl-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-heptan-4-yl-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 104694875 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | N-heptan-4-yl-2,3-dihydro-1H-inden-2-amine |
| SMILES | CCCC(CCC)NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H25N/c1-3-7-15(8-4-2)17-16-11-13-9-5-6-10-14(13)12-16/h5-6,9-10,15-17H,3-4,7-8,11-12H2,1-2H3 |
| InChIKey | GMCWSLMVPYHKDP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |