C15H19N — CID 106227277
N-hex-1-yn-3-yl-2,3-dihydro-1H-inden-2-amine (PubChem CID 106227277) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is N-hex-1-yn-3-yl-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-hex-1-yn-3-yl-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 106227277 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | N-hex-1-yn-3-yl-2,3-dihydro-1H-inden-2-amine |
| SMILES | C#CC(CCC)NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H19N/c1-3-7-14(4-2)16-15-10-12-8-5-6-9-13(12)11-15/h2,5-6,8-9,14-16H,3,7,10-11H2,1H3 |
| InChIKey | XJDHOGUQAUCOMB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|