C16H20BrN — CID 106226118
6-bromo-N-hex-1-yn-3-yl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 106226118) has the molecular formula C16H20BrN and a molecular weight of 306.25 g/mol. Its IUPAC name is 6-bromo-N-hex-1-yn-3-yl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 6-bromo-N-hex-1-yn-3-yl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 106226118 |
| Molecular Formula | C16H20BrN |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 6-bromo-N-hex-1-yn-3-yl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | C#CC(CCC)NC1CCc2cc(Br)ccc2C1 |
| InChI | InChI=1S/C16H20BrN/c1-3-5-15(4-2)18-16-9-7-12-10-14(17)8-6-13(12)11-16/h2,6,8,10,15-16,18H,3,5,7,9,11H2,1H3 |
| InChIKey | OGKZOQNRQPBDER-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|