C18H28BrN — CID 63625695
6-bromo-N-octan-2-yl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 63625695) has the molecular formula C18H28BrN and a molecular weight of 338.33 g/mol. Its IUPAC name is 6-bromo-N-octan-2-yl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 6-bromo-N-octan-2-yl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 63625695 |
| Molecular Formula | C18H28BrN |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 6-bromo-N-octan-2-yl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCCCCC(C)NC1CCc2cc(Br)ccc2C1 |
| InChI | InChI=1S/C18H28BrN/c1-3-4-5-6-7-14(2)20-18-11-9-15-12-17(19)10-8-16(15)13-18/h8,10,12,14,18,20H,3-7,9,11,13H2,1-2H3 |
| InChIKey | HWQCQGBTIHAAEJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|